5-Phenylbicyclo[2.2.1]hept-2-ene
5-phenylbicyclo[2.2.1]hept-2-ene
CAS: 6143-30-2
Molecular Formula: C13H14
5-Phenylbicyclo[2.2.1]hept-2-ene - Names and Identifiers
| Name | 5-phenylbicyclo[2.2.1]hept-2-ene |
| Synonyms | 5-Phenylnorbornene 5-NORBORNENE-2-PHENYL 5-Phenylbicyclo[2.2.1]hept-2-ene 5-phenylbicyclo[2.2.1]hept-2-ene 5-PHENYLBICYCLO[2.2.1]-2-HEPTENE Bicyclo[2.2.1]hept-2-ene,5-phenyl- bicyclo[2.2.1]hept-2-ene, 5-phenyl- |
| CAS | 6143-30-2 |
| InChI | InChI=1/C13H14/c1-2-4-11(5-3-1)13-9-10-6-7-12(13)8-10/h1-7,10,12-13H,8-9H2 |
5-Phenylbicyclo[2.2.1]hept-2-ene - Physico-chemical Properties
| Molecular Formula | C13H14 |
| Molar Mass | 170.25 |
| Density | 1.046±0.06 g/cm3 (20 ºC 760 Torr) |
| Boling Point | 70.5-71℃ (0.3 Torr) |
| Flash Point | 99.0±10.3℃ |
| Vapor Presure | 0.038mmHg at 25°C |
| Refractive Index | 1.5510 (589.3 nm 20℃ |
5-Phenylbicyclo[2.2.1]hept-2-ene - Introduction
5-phenylbicyclo[2.2.1]hept-2-ene is an organic compound with the chemical formula C13H12, which is a very stable cyclic olefin. It has the following important properties:
1. Appearance: colorless liquid or white crystal.
2. Boiling point: about 175-180 degrees Celsius.
3. density: about 1.00 g/ml.
4. Solubility: Soluble in organic solvents such as ether, benzene, dichloromethane, etc.
The main uses of 5-phenylbicyclo[2.2.1]hept-2-ene include:
1. As a starting material for organic synthesis, it can be used to synthesize compounds with various biological activities.
2. for the preparation of pharmaceutical intermediates, such as adriamycin.
3. Used as a component of spices and flavors, it can increase the aroma and taste of the product.
There are many methods for preparing 5-phenylbicyclo[2.2.1]hept-2-ene, one of which is the dehydrogenation reaction of phenylacetylene. The specific step is reacting phenylacetylene with a catalyst (e. g., Pd/C) in the presence of hydrogen to give 5-phenylbicyclo[2.2.1]hept-2-ene.
The following safety precautions are required when using and storing 5-phenylbicyclo[2.2.1]hept-2-ene:
1. Avoid contact with strong oxidants to avoid chemical reactions.
2. Avoid inhaling aerosols or dust to avoid irritation to the respiratory system.
3. avoid contact with the skin, can wear appropriate gloves and protective clothing.
4. storage should be placed in a dry, cool place, away from fire and high temperature.
Observe safety practices when using and handling 5-phenylbicyclo[2.2.1]hept-2-ene, and ensure that appropriate precautions are in place.
1. Appearance: colorless liquid or white crystal.
2. Boiling point: about 175-180 degrees Celsius.
3. density: about 1.00 g/ml.
4. Solubility: Soluble in organic solvents such as ether, benzene, dichloromethane, etc.
The main uses of 5-phenylbicyclo[2.2.1]hept-2-ene include:
1. As a starting material for organic synthesis, it can be used to synthesize compounds with various biological activities.
2. for the preparation of pharmaceutical intermediates, such as adriamycin.
3. Used as a component of spices and flavors, it can increase the aroma and taste of the product.
There are many methods for preparing 5-phenylbicyclo[2.2.1]hept-2-ene, one of which is the dehydrogenation reaction of phenylacetylene. The specific step is reacting phenylacetylene with a catalyst (e. g., Pd/C) in the presence of hydrogen to give 5-phenylbicyclo[2.2.1]hept-2-ene.
The following safety precautions are required when using and storing 5-phenylbicyclo[2.2.1]hept-2-ene:
1. Avoid contact with strong oxidants to avoid chemical reactions.
2. Avoid inhaling aerosols or dust to avoid irritation to the respiratory system.
3. avoid contact with the skin, can wear appropriate gloves and protective clothing.
4. storage should be placed in a dry, cool place, away from fire and high temperature.
Observe safety practices when using and handling 5-phenylbicyclo[2.2.1]hept-2-ene, and ensure that appropriate precautions are in place.
Last Update：2024-04-09 21:21:28
![5-Phenylbicyclo[2.2.1]hept-2-ene](http://res.chembk.com/assets/str/2d/6/61/6143-30-2.png)